|
CAS#: 21908-85-0 Product: 4-Chloro-9H-Thioxanthen-9-One No suppilers available for the product. |
| Name | 4-Chloro-9H-Thioxanthen-9-One |
|---|---|
| Synonyms | 4-Chloro-9-Thioxanthenone; 4-Chloro-9H-Thioxanthen-9-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H7ClOS |
| Molecular Weight | 246.71 |
| CAS Registry Number | 21908-85-0 |
| EINECS | 244-655-2 |
| SMILES | C1=CC=C(Cl)C3=C1C(=O)C2=CC=CC=C2S3 |
| InChI | 1S/C13H7ClOS/c14-10-6-3-5-9-12(15)8-4-1-2-7-11(8)16-13(9)10/h1-7H |
| InChIKey | SGSKTOKJZHJRCN-UHFFFAOYSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.519°C at 760 mmHg (Cal.) |
| Flash point | 193.608°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-9H-Thioxanthen-9-One |