Online Database of Chemicals from Around the World
|
CAS#: 234-03-7 Product: Benzo[g][1]Benzoxole No suppilers available for the product. |
| Name | Benzo[g][1]Benzoxole |
|---|---|
| Synonyms | Benzo[G]Benzofuran; Naphtho(1,2-B)Furan |
| Molecular Structure | ![CAS#: 234-03-7, Benzo[g][1]Benzoxole](/moreStructures/234-03-7.gif) |
| Molecular Formula | C12H8O |
| Molecular Weight | 168.19 |
| CAS Registry Number | 234-03-7 |
| EINECS | 205-940-7 |
| SMILES | C2=CC1=CC=C3C(=C1O2)C=CC=C3 |
| InChI | 1S/C12H8O/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11/h1-8H |
| InChIKey | BAWIKCOPJPVUKL-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.082°C at 760 mmHg (Cal.) |
| Flash point | 139.654°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[g][1]Benzoxole |