|
CAS#: 24885-60-7 Product: (1R,3R)-rel-1-Amino-1,3-Cyclohexanedicarboxylic acid No suppilers available for the product. |
| Name | (1R,3R)-rel-1-Amino-1,3-Cyclohexanedicarboxylic acid |
|---|---|
| Synonyms | 1-Amino-1,3-Cyclohexanedicarboxylic Acid; Cycloglutamate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.20 |
| CAS Registry Number | 24885-60-7 |
| SMILES | [C@@]1(C[C@@H](CCC1)C(=O)O)(C(=O)O)N |
| InChI | 1S/C8H13NO4/c9-8(7(12)13)3-1-2-5(4-8)6(10)11/h5H,1-4,9H2,(H,10,11)(H,12,13)/t5-,8-/m1/s1 |
| InChIKey | FOJYRYZUTAPBAJ-SVGQVSJJSA-N |
| Density | 1.367g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.114°C at 760 mmHg (Cal.) |
| Flash point | 173.406°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,3R)-rel-1-Amino-1,3-Cyclohexanedicarboxylic acid |