Online Database of Chemicals from Around the World
| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (203) 786-5290 | |||
 |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Name | 11-Methylbenzo[c]Phenanthrene |
|---|---|
| Synonyms | 2-Methyl-3,4-Benzophenanthrene; 2-Methylbenzo(C)Phenanthrene; 6-Methyl-3:4-Benzphenanthrene |
| Molecular Structure | ![CAS#: 2606-85-1, 11-Methylbenzo[c]Phenanthrene](/moreStructures/2606-85-1.gif) |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 |
| CAS Registry Number | 2606-85-1 |
| SMILES | C1=C(C)C=CC2=C1C3=C(C=C2)C=CC4=CC=CC=C34 |
| InChI | 1S/C19H14/c1-13-6-7-15-9-11-16-10-8-14-4-2-3-5-17(14)19(16)18(15)12-13/h2-12H,1H3 |
| InChIKey | BJUXRTTZOOHUQP-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.425°C at 760 mmHg (Cal.) |
| Flash point | 217.844°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 11-Methylbenzo[c]Phenanthrene |