|
CAS#: 27693-70-5 Product: 2-(3-Nitroanilino)benzoic acid No suppilers available for the product. |
| Name | 2-(3-Nitroanilino)benzoic acid |
|---|---|
| Synonyms | Benzoic Acid, 2-((3-Nitrophenyl)Amino)- (9Ci); N-M-Nitrophenylanthranilic Acid; Nsc 509690 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 |
| CAS Registry Number | 27693-70-5 |
| SMILES | C1=CC=CC(=C1NC2=CC=CC(=C2)[N+](=O)[O-])C(O)=O |
| InChI | 1S/C13H10N2O4/c16-13(17)11-6-1-2-7-12(11)14-9-4-3-5-10(8-9)15(18)19/h1-8,14H,(H,16,17) |
| InChIKey | NBJRFLIUYUFOIR-UHFFFAOYSA-N |
| Density | 1.436g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.005°C at 760 mmHg (Cal.) |
| Flash point | 221.117°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(3-Nitroanilino)benzoic acid |