|
CAS#: 28223-40-7 Product: Lyxonic Acid No suppilers available for the product. |
| Name | Lyxonic Acid |
|---|---|
| Synonyms | (2S,3S,4R)-2,3,4,5-Tetrahydroxyvaleric Acid; Oprea1_683221; Lyxonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O6 |
| Molecular Weight | 166.13 |
| CAS Registry Number | 28223-40-7 |
| SMILES | [C@H]([C@H]([C@H](O)CO)O)(C(=O)O)O |
| InChI | 1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3+,4+/m1/s1 |
| InChIKey | QXKAIJAYHKCRRA-UZBSEBFBSA-N |
| Density | 1.715g/cm3 (Cal.) |
|---|---|
| Boiling point | 583.987°C at 760 mmHg (Cal.) |
| Flash point | 321.023°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lyxonic Acid |