|
CAS#: 311-44-4 Product: Bis(2-Chloroethyl) (4-Nitrophenyl) Phosphate No suppilers available for the product. |
| Name | Bis(2-Chloroethyl) (4-Nitrophenyl) Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Bis(2-Chloroethyl) (4-Nitrophenyl) Ester; 110H60; 2-Chloroethyl Paraoxon |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12Cl2NO6P |
| Molecular Weight | 344.09 |
| CAS Registry Number | 311-44-4 |
| SMILES | C1=CC(=CC=C1O[P](OCCCl)(=O)OCCCl)[N+]([O-])=O |
| InChI | 1S/C10H12Cl2NO6P/c11-5-7-17-20(16,18-8-6-12)19-10-3-1-9(2-4-10)13(14)15/h1-4H,5-8H2 |
| InChIKey | IDERFWIIXARCJS-UHFFFAOYSA-N |
| Density | 1.468g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.246°C at 760 mmHg (Cal.) |
| Flash point | 209.772°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Chloroethyl) (4-Nitrophenyl) Phosphate |