|
CAS#: 32594-70-0 Product: 1-Methyl-2-(1,3-Thiazol-4-Yl)Benzimidazole No suppilers available for the product. |
| Name | 1-Methyl-2-(1,3-Thiazol-4-Yl)Benzimidazole |
|---|---|
| Synonyms | 1-Methyl-2-Thiazol-4-Yl-Benzimidazole; 1-Methyl-2-(4-Thiazolyl)Benzimidazole; N-Methylthiabendazole |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.27 |
| CAS Registry Number | 32594-70-0 |
| SMILES | C2=C1N=C([N](C1=CC=C2)C)C3=CSC=N3 |
| InChI | 1S/C11H9N3S/c1-14-10-5-3-2-4-8(10)13-11(14)9-6-15-7-12-9/h2-7H,1H3 |
| InChIKey | CSAHSZPPHOXJAP-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.977°C at 760 mmHg (Cal.) |
| Flash point | 207.795°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-2-(1,3-Thiazol-4-Yl)Benzimidazole |