|
CAS#: 32595-29-2 Product: 4,4-Dimethyl-1-Phenylimidazolidine-2-Thione No suppilers available for the product. |
| Name | 4,4-Dimethyl-1-Phenylimidazolidine-2-Thione |
|---|---|
| Synonyms | 4,4-Dimethyl-1-Phenyl-Imidazolidine-2-Thione; 4,4-Dimethyl-1-Phenyl-2-Imidazolidinethione; 1-Phenyl-4,4-Dimethyl-2-Imidazolidinethione |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 |
| CAS Registry Number | 32595-29-2 |
| SMILES | C2=C(N1CC(NC1=S)(C)C)C=CC=C2 |
| InChI | 1S/C11H14N2S/c1-11(2)8-13(10(14)12-11)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,12,14) |
| InChIKey | VSWFMNJNVGGNJK-UHFFFAOYSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.3°C at 760 mmHg (Cal.) |
| Flash point | 125.136°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethyl-1-Phenylimidazolidine-2-Thione |