|
CAS#: 32606-03-4 Product: 1,3,3-Trimethylquinoline-2,4-Dione No suppilers available for the product. |
| Name | 1,3,3-Trimethylquinoline-2,4-Dione |
|---|---|
| Synonyms | 1,3,3-Trimethylquinoline-2,4-Quinone; 1,3,3-Trimethyl-2,4(1H,3H)-Quinolinedione; 2,4(1H,3H)-Quinolinedione, 1,3,3-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 32606-03-4 |
| SMILES | C2=C1C(C(C(N(C1=CC=C2)C)=O)(C)C)=O |
| InChI | 1S/C12H13NO2/c1-12(2)10(14)8-6-4-5-7-9(8)13(3)11(12)15/h4-7H,1-3H3 |
| InChIKey | YZTMKCCMFARKLV-UHFFFAOYSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.033°C at 760 mmHg (Cal.) |
| Flash point | 190.049°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,3-Trimethylquinoline-2,4-Dione |