| CacheSyn Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (416) 996-8186 | |||
![]() |
info@cachesyn.com | |||
| Chemical manufacturer | ||||
| Name | [3-Methyl-4-Methylamino-1,2-Di(Phenyl)Butan-2-Yl] Propanoate |
|---|---|
| Synonyms | [2-Methyl-3-Methylamino-1-Phenyl-1-(Phenylmethyl)Propyl] Propanoate; Propanoic Acid [2-Methyl-3-Methylamino-1-Phenyl-1-(Phenylmethyl)Propyl] Ester; Propionic Acid [1-(Benzyl)-2-Methyl-3-Methylamino-1-Phenyl-Propyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 |
| CAS Registry Number | 3376-94-1 |
| SMILES | C1=CC=CC=C1C(CC2=CC=CC=C2)(C(CNC)C)OC(CC)=O |
| InChI | 1S/C21H27NO2/c1-4-20(23)24-21(17(2)16-22-3,19-13-9-6-10-14-19)15-18-11-7-5-8-12-18/h5-14,17,22H,4,15-16H2,1-3H3 |
| InChIKey | IKACRWYHQXOSGM-UHFFFAOYSA-N |
| Density | 1.043g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.721°C at 760 mmHg (Cal.) |
| Flash point | 223.969°C (Cal.) |
| (1) | William Bains, Antranig Basman and Cat White. hERG binding specificity and binding site structure: evidence from a fragment-based evolutionary computing SAR study, Progress in Biophysics and Molecular Biology 2004, 86 (2), 205-233 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for [3-Methyl-4-Methylamino-1,2-Di(Phenyl)Butan-2-Yl] Propanoate |