|
CAS#: 3414-67-3 Product: N-Butyl-N-[(5-Nitro-1H-Indol-3-Yl)Methyl]Butan-1-Amine No suppilers available for the product. |
| Name | N-Butyl-N-[(5-Nitro-1H-Indol-3-Yl)Methyl]Butan-1-Amine |
|---|---|
| Synonyms | Dibutyl-[(5-Nitro-1H-Indol-3-Yl)Methyl]Amine; 3-((Dibutylamino)Methyl)-5-Nitroindole; 5-Nitro-3-(Dibutylaminomethyl)Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.40 |
| CAS Registry Number | 3414-67-3 |
| SMILES | C1=C([N+]([O-])=O)C=CC2=C1C(=C[NH]2)CN(CCCC)CCCC |
| InChI | 1S/C17H25N3O2/c1-3-5-9-19(10-6-4-2)13-14-12-18-17-8-7-15(20(21)22)11-16(14)17/h7-8,11-12,18H,3-6,9-10,13H2,1-2H3 |
| InChIKey | SXZLXOISSHULKG-UHFFFAOYSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.455°C at 760 mmHg (Cal.) |
| Flash point | 225.018°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Butyl-N-[(5-Nitro-1H-Indol-3-Yl)Methyl]Butan-1-Amine |