|
CAS#: 34594-44-0 Product: 3-(4-Ethoxyphenyl)-2-Methylpteridin-4-One No suppilers available for the product. |
| Name | 3-(4-Ethoxyphenyl)-2-Methylpteridin-4-One |
|---|---|
| Synonyms | 3-(4-Ethoxyphenyl)-2-Methyl-Pteridin-4-One; 3-(4-Ethoxyphenyl)-2-Methyl-4-Pteridinone; 3-(P-Ethoxyphenyl)-2-Methyl-4(3H)-Pteridinone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 |
| CAS Registry Number | 34594-44-0 |
| SMILES | C3=NC1=C(N=C(N(C1=O)C2=CC=C(C=C2)OCC)C)N=C3 |
| InChI | 1S/C15H14N4O2/c1-3-21-12-6-4-11(5-7-12)19-10(2)18-14-13(15(19)20)16-8-9-17-14/h4-9H,3H2,1-2H3 |
| InChIKey | NVPHRKOYLQIZSC-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.189°C at 760 mmHg (Cal.) |
| Flash point | 249.653°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Ethoxyphenyl)-2-Methylpteridin-4-One |