Online Database of Chemicals from Around the World
|
CAS#: 34624-81-2 Product: 2,6-Ditert-Butyl-4-(2-Phenylpropan-2-Yl)Phenol No suppilers available for the product. |
| Name | 2,6-Ditert-Butyl-4-(2-Phenylpropan-2-Yl)Phenol |
|---|---|
| Synonyms | 2,6-Ditert-Butyl-4-(1-Methyl-1-Phenyl-Ethyl)Phenol; 2,6-Ditert-Butyl-4-(1-Methyl-1-Phenylethyl)Phenol |
| Molecular Structure |  |
| Molecular Formula | C23H32O |
| Molecular Weight | 324.51 |
| CAS Registry Number | 34624-81-2 |
| EINECS | 252-121-5 |
| SMILES | C2=C(C(C1=CC=CC=C1)(C)C)C=C(C(C)(C)C)C(=C2C(C)(C)C)O |
| InChI | 1S/C23H32O/c1-21(2,3)18-14-17(15-19(20(18)24)22(4,5)6)23(7,8)16-12-10-9-11-13-16/h9-15,24H,1-8H3 |
| InChIKey | ROEHFIIRMUXFRR-UHFFFAOYSA-N |
| Density | 0.97g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.427°C at 760 mmHg (Cal.) |
| Flash point | 168.818°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Ditert-Butyl-4-(2-Phenylpropan-2-Yl)Phenol |