|
CAS#: 35104-18-8 Product: Ethyl N-Carbamoyl-N-Phenylcarbamate No suppilers available for the product. |
| Name | Ethyl N-Carbamoyl-N-Phenylcarbamate |
|---|---|
| Synonyms | Ethyl N-Carbamoyl-N-Phenyl-Carbamate; N-Carbamoyl-N-Phenylcarbamic Acid Ethyl Ester; N-Carbamoyl-N-Phenyl-Carbamic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 |
| CAS Registry Number | 35104-18-8 |
| SMILES | C1=C(N(C(OCC)=O)C(N)=O)C=CC=C1 |
| InChI | 1S/C10H12N2O3/c1-2-15-10(14)12(9(11)13)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H2,11,13) |
| InChIKey | VCGUVRCFKLUCRS-UHFFFAOYSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.647°C at 760 mmHg (Cal.) |
| Flash point | 148.932°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N-Carbamoyl-N-Phenylcarbamate |