|
CAS#: 35873-40-6 Product: 8-Butyl-1,3-Dimethyl-7H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 8-Butyl-1,3-Dimethyl-7H-Purine-2,6-Dione |
|---|---|
| Synonyms | 8-Butyl-1,3-Dimethyl-7H-Purine-2,6-Quinone; 1H-Purine-2,6-Dione, 8-Butyl-3,7-Dihydro-1,3-Dimethyl- (9Ci); 4-26-00-02478 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 35873-40-6 |
| SMILES | C(C2=NC1=C(C(N(C(N1C)=O)C)=O)[NH]2)CCC |
| InChI | 1S/C11H16N4O2/c1-4-5-6-7-12-8-9(13-7)14(2)11(17)15(3)10(8)16/h4-6H2,1-3H3,(H,12,13) |
| InChIKey | VPISOLDSBFMXDM-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.584°C at 760 mmHg (Cal.) |
| Flash point | 237.191°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Butyl-1,3-Dimethyl-7H-Purine-2,6-Dione |