|
CAS#: 37558-01-3 Product: 2-Sulfamoylbenzoic Acid No suppilers available for the product. |
| Name | 2-Sulfamoylbenzoic Acid |
|---|---|
| Synonyms | Benzoic Acid, 2-(Aminosulfonyl)-, Monosodium Salt; Benzoic Acid, 2-(Aminosulfonyl)-, Monsodium Salt; Benzoic Acid, 2-(Aminosulfonyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7NO4S |
| Molecular Weight | 201.20 |
| CAS Registry Number | 37558-01-3 |
| SMILES | C1=C(C(=CC=C1)[S](N)(=O)=O)C(=O)O |
| InChI | 1S/C7H7NO4S/c8-13(11,12)6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10)(H2,8,11,12) |
| InChIKey | KDNIOKSLVIGAAN-UHFFFAOYSA-N |
| Density | 1.537g/cm3 (Cal.) |
|---|---|
| Melting point | 150-152°C (Expl.) |
| Boiling point | 454.764°C at 760 mmHg (Cal.) |
| Flash point | 228.834°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Sulfamoylbenzoic Acid |