|
CAS#: 3932-30-7 Product: 5-Fluoroacenaphthen-1-One No suppilers available for the product. |
| Name | 5-Fluoroacenaphthen-1-One |
|---|---|
| Synonyms | 5-Fluoro-1-Acenaphthenone; 5-Fluoro-1(2H)-Acenaphthylenone; 1(2H)-Acenaphthylenone, 5-Fluoro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7FO |
| Molecular Weight | 186.19 |
| CAS Registry Number | 3932-30-7 |
| SMILES | C1=CC(=C2C=CC=C3C(CC1=C23)=O)F |
| InChI | 1S/C12H7FO/c13-10-5-4-7-6-11(14)9-3-1-2-8(10)12(7)9/h1-5H,6H2 |
| InChIKey | SDBKSQFTHDLBQS-UHFFFAOYSA-N |
| Density | 1.373g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.922°C at 760 mmHg (Cal.) |
| Flash point | 123.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Fluoroacenaphthen-1-One |