|
CAS#: 39327-98-5 Product: 6-Chloro-2-(Trifluoromethyl)-1H-Imidazo[4,5-b]Pyridine No suppilers available for the product. |
| Name | 6-Chloro-2-(Trifluoromethyl)-1H-Imidazo[4,5-b]Pyridine |
|---|---|
| Synonyms | Zinc03895715; Mls000087639; Stock1s-13589 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H3ClF3N3 |
| Molecular Weight | 221.57 |
| CAS Registry Number | 39327-98-5 |
| SMILES | C1=C(Cl)C=NC2=C1[NH]C(=N2)C(F)(F)F |
| InChI | 1S/C7H3ClF3N3/c8-3-1-4-5(12-2-3)14-6(13-4)7(9,10)11/h1-2H,(H,12,13,14) |
| InChIKey | QJYOCYOOZHULNN-UHFFFAOYSA-N |
| Density | 1.656g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.649°C at 760 mmHg (Cal.) |
| Flash point | 133.813°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-2-(Trifluoromethyl)-1H-Imidazo[4,5-b]Pyridine |