|
CAS#: 39388-66-4 Product: Inflexin (I) No suppilers available for the product. |
| Name | Inflexin (I) |
|---|---|
| Synonyms | Inflexin; Inflexin (I) |
| Molecular Structure | ![]() |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 |
| CAS Registry Number | 39388-66-4 |
| SMILES | [C@]234[C@H]([C@@]1([C@@H](C[C@@H](C([C@H]1C(C2)=O)(C)C)OC(=O)C)OC(=O)C)C)[C@H](O)C[C@H](C3)C(C4=O)=C |
| InChI | 1S/C24H32O7/c1-11-14-7-15(27)20-23(6)18(31-13(3)26)8-17(30-12(2)25)22(4,5)19(23)16(28)10-24(20,9-14)21(11)29/h14-15,17-20,27H,1,7-10H2,2-6H3/t14-,15-,17+,18-,19-,20+,23-,24+/m1/s1 |
| InChIKey | YVMIOJMVICZZJA-UIZRKYKGSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 557.803°C at 760 mmHg (Cal.) |
| Flash point | 185.435°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Inflexin (I) |