|
CAS#: 398-89-0 Product: N-(5-Chloro-2-Fluorophenyl)Acetamide No suppilers available for the product. |
| Name | N-(5-Chloro-2-Fluorophenyl)Acetamide |
|---|---|
| Synonyms | N-(5-Chloro-2-Fluoro-Phenyl)Acetamide; N-(5-Chloro-2-Fluoro-Phenyl)Ethanamide; 5'-Chloro-2'-Fluoroacetanilide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7ClFNO |
| Molecular Weight | 187.60 |
| CAS Registry Number | 398-89-0 |
| SMILES | C1=C(C=CC(=C1NC(C)=O)F)Cl |
| InChI | 1S/C8H7ClFNO/c1-5(12)11-8-4-6(9)2-3-7(8)10/h2-4H,1H3,(H,11,12) |
| InChIKey | UPSPWQXTRIIBEC-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.409°C at 760 mmHg (Cal.) |
| Flash point | 143.949°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(5-Chloro-2-Fluorophenyl)Acetamide |