Online Database of Chemicals from Around the World
|
CAS#: 4032-80-8 Product: Di-o-Tolyl Disulphide No suppilers available for the product. |
| Name | Di-o-Tolyl Disulphide |
|---|---|
| Synonyms | 1-Methyl-2-(2-Methylphenyl)Disulfanyl-Benzene; Di-O-Tolyl Disulphide; Bis(Methylphenyl) Disulphide |
| Molecular Structure |  |
| Molecular Formula | C14H14S2 |
| Molecular Weight | 246.38 |
| CAS Registry Number | 4032-80-8 (61886-58-6) |
| EINECS | 223-715-1 |
| SMILES | C2=C(SSC1=C(C=CC=C1)C)C(=CC=C2)C |
| InChI | 1S/C14H14S2/c1-11-7-3-5-9-13(11)15-16-14-10-6-4-8-12(14)2/h3-10H,1-2H3 |
| InChIKey | ZSSCTTQONPHGRA-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.858°C at 760 mmHg (Cal.) |
| Flash point | 162.861°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di-o-Tolyl Disulphide |