|
CAS#: 41453-50-3 Product: Lead Bis(2,4-Dihydroxybenzoate) No suppilers available for the product. |
| Name | Lead Bis(2,4-Dihydroxybenzoate) |
|---|---|
| Synonyms | Plumbous 2,4-Dihydroxybenzoate; Benzoic Acid, 2,4-Dihydroxy-, Lead(2+) Salt (2:1); Bis(2,4-Dihydroxyl)Benzoatolead(Ii) |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O8Pb |
| Molecular Weight | 513.43 |
| CAS Registry Number | 41453-50-3 |
| EINECS | 255-375-5 |
| SMILES | C1=CC(=CC(=C1C([O-])=O)O)O.C2=CC(=CC(=C2C([O-])=O)O)O.[Pb++] |
| InChI | 1S/2C7H6O4.Pb/c2*8-4-1-2-5(7(10)11)6(9)3-4;/h2*1-3,8-9H,(H,10,11);/q;;+2/p-2 |
| InChIKey | CQGXUYYUUPEUIH-UHFFFAOYSA-L |
| Boiling point | 414.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 218.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lead Bis(2,4-Dihydroxybenzoate) |