|
CAS#: 41758-66-1 Product: (±)-Stemonamine No suppilers available for the product. |
| Name | (±)-Stemonamine |
|---|---|
| Synonyms | Spiro(1H-Cyclopenta(B)Pyrrolo(1,2-A)Azepine-11(10H),2'(5'H)-Furan)-5',10-Dione, 2,3,5,6,7,8-Hexahydro-3'-Methoxy-4',9-Dimethyl-, (2'R*,11As*)-; Spiro(1H-Cyclopenta(B)Pyrrolo(1,2-A)Azepine-11(10H),2'(5'H)-Furan)-5',10-Dione, 2,3,5,6,7,8-Hexahydro-3'-Methoxy-4',9-Dimethyl-, (2'R,11As)-Rel-; Spiro(1H-Cyclopenta(B)Pyrrolo(1,2-A)Azepine-11(10H),2'(5'H)-Furan)-5',10-Dione, 2,3,5,6,7,8-Hexahydro-3'-Methoxy-4',9-Dimethyl-, (2'R*,11Ar*)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 |
| CAS Registry Number | 41758-66-1 (41758-67-2) |
| SMILES | CC4=C2C1(N(CCC1)CCCC2)C3(OC(=O)C(=C3OC)C)C4=O |
| InChI | 1S/C18H23NO4/c1-11-13-7-4-5-9-19-10-6-8-17(13,19)18(14(11)20)15(22-3)12(2)16(21)23-18/h4-10H2,1-3H3 |
| InChIKey | YRGLLFADJRHUKM-UHFFFAOYSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.837°C at 760 mmHg (Cal.) |
| Flash point | 295.403°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (±)-Stemonamine |