|
CAS#: 4176-17-4 Product: alpha-Curcumene No suppilers available for the product. |
| Name | alpha-Curcumene |
|---|---|
| Synonyms | 1-[(1R)-1,5-Dimethylhex-4-Enyl]-4-Methyl-Benzene; 1-[(1R)-1,5-Dimethylhex-4-Enyl]-4-Methylbenzene; C09649 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 |
| CAS Registry Number | 4176-17-4 |
| SMILES | [C@H](C1=CC=C(C=C1)C)(CCC=C(C)C)C |
| InChI | 1S/C15H22/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8-11,14H,5,7H2,1-4H3/t14-/m1/s1 |
| InChIKey | VMYXUZSZMNBRCN-CQSZACIVSA-N |
| Density | 0.873g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.32°C at 760 mmHg (Cal.) |
| Flash point | 117.206°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Curcumene |