|
CAS#: 4559-30-2 Product: Potassium 2,3,6-Trichlorobenzoate No suppilers available for the product. |
| Name | Potassium 2,3,6-Trichlorobenzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H2Cl3KO2 |
| Molecular Weight | 263.55 |
| CAS Registry Number | 4559-30-2 |
| EINECS | 224-927-7 |
| SMILES | C1=C(Cl)C(=C(Cl)C(=C1)Cl)C([O-])=O.[K+] |
| InChI | 1S/C7H3Cl3O2.K/c8-3-1-2-4(9)6(10)5(3)7(11)12;/h1-2H,(H,11,12);/q;+1/p-1 |
| InChIKey | KJMADHVXBWVFBX-UHFFFAOYSA-M |
| Boiling point | 324.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 150.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 2,3,6-Trichlorobenzoate |