|
CAS#: 46464-11-3 Product: Meobentine No suppilers available for the product. |
| Name | Meobentine |
|---|---|
| Synonyms | 1-[(4-Methoxyphenyl)Methyl]-2,3-Dimethyl-Guanidine; Sulfuric Acid; 2,3-Dimethyl-1-P-Anisyl-Guanidine; Sulfuric Acid; D04920 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H36N6O6S |
| Molecular Weight | 512.62 |
| CAS Registry Number | 46464-11-3 (58503-79-0) |
| SMILES | O=[S](=O)(O)O.C1=C(C=CC(=C1)OC)CNC(=NC)NC.C(NC(=NC)NC)C2=CC=C(OC)C=C2 |
| InChI | 1S/2C11H17N3O.H2O4S/c2*1-12-11(13-2)14-8-9-4-6-10(15-3)7-5-9;1-5(2,3)4/h2*4-7H,8H2,1-3H3,(H2,12,13,14);(H2,1,2,3,4) |
| InChIKey | LVEGWDSAJVVBHT-UHFFFAOYSA-N |
| Boiling point | 325.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 150.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Meobentine |