|
CAS#: 46885-76-1 Product: 6-Nitrotryptophan No suppilers available for the product. |
| Name | 6-Nitrotryptophan |
|---|---|
| Synonyms | 2-Amino-3-(6-Nitro-1H-Indol-3-Yl)Propionic Acid; 6-Nitrotryptophan; L-Tryptophan, 6-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 |
| CAS Registry Number | 46885-76-1 |
| SMILES | C1=C(CC(N)C(O)=O)C2=C([NH]1)C=C([N+]([O-])=O)C=C2 |
| InChI | 1S/C11H11N3O4/c12-9(11(15)16)3-6-5-13-10-4-7(14(17)18)1-2-8(6)10/h1-2,4-5,9,13H,3,12H2,(H,15,16) |
| InChIKey | AWLWPSSHYJQPCH-UHFFFAOYSA-N |
| Density | 1.541g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.672°C at 760 mmHg (Cal.) |
| Flash point | 277.16°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Nitrotryptophan |