|
CAS#: 47119-84-6 Product: 1-Isocyanato-3-(3-Isocyanatophenyl)Sulfonyl-Benzene No suppilers available for the product. |
| Name | 1-Isocyanato-3-(3-Isocyanatophenyl)Sulfonyl-Benzene |
|---|---|
| Synonyms | 1-Isocyanato-3-(3-Isocyanatophenyl)Sulfonyl-Benzene; Nsc40768; Aids032706 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8N2O4S |
| Molecular Weight | 300.29 |
| CAS Registry Number | 47119-84-6 |
| SMILES | O=C=NC1=CC=CC(=C1)[S](C2=CC(=CC=C2)N=C=O)(=O)=O |
| InChI | 1S/C14H8N2O4S/c17-9-15-11-3-1-5-13(7-11)21(19,20)14-6-2-4-12(8-14)16-10-18/h1-8H |
| InChIKey | YLLYHGYVPJDNCX-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.51°C at 760 mmHg (Cal.) |
| Flash point | 251.057°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Isocyanato-3-(3-Isocyanatophenyl)Sulfonyl-Benzene |