|
CAS#: 4824-72-0 Product: 4-Nitro-2,3,5,6-Tetrachlorophenol No suppilers available for the product. |
| Name | 4-Nitro-2,3,5,6-Tetrachlorophenol |
|---|---|
| Synonyms | 2,3,5,6-Tetrachloro-4-Nitro-Phenol; 4-Nitro-2,3,5,6-Tetrachlorophenol; Nsc407822 |
| Molecular Structure | ![]() |
| Molecular Formula | C6HCl4NO3 |
| Molecular Weight | 276.89 |
| CAS Registry Number | 4824-72-0 |
| SMILES | C1(=C(Cl)C(=C(O)C(=C1Cl)Cl)Cl)[N+]([O-])=O |
| InChI | 1S/C6HCl4NO3/c7-1-3(9)6(12)4(10)2(8)5(1)11(13)14/h12H |
| InChIKey | KTOJSFDUFPFOBF-UHFFFAOYSA-N |
| Density | 1.877g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.2°C at 760 mmHg (Cal.) |
| Flash point | 158.943°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-2,3,5,6-Tetrachlorophenol |