Online Database of Chemicals from Around the World
|
CAS#: 4829-62-3 Product: 4-Amino-3,3'-Dimethylazobenzene No suppilers available for the product. |
| Name | 4-Amino-3,3'-Dimethylazobenzene |
|---|---|
| Synonyms | 2-Methyl-4-(3-Methylphenyl)Azo-Aniline; 2-Methyl-4-(3-Methylphenyl)Azoaniline; [2-Methyl-4-(3-Methylphenyl)Azo-Phenyl]Amine |
| Molecular Structure |  |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 |
| CAS Registry Number | 4829-62-3 |
| SMILES | C1=C(C(=CC=C1N=NC2=CC=CC(=C2)C)N)C |
| InChI | 1S/C14H15N3/c1-10-4-3-5-12(8-10)16-17-13-6-7-14(15)11(2)9-13/h3-9H,15H2,1-2H3 |
| InChIKey | FKTXSJWQORNULK-UHFFFAOYSA-N |
| Density | 1.097g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.894°C at 760 mmHg (Cal.) |
| Flash point | 202.302°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-3,3'-Dimethylazobenzene |