|
CAS#: 49848-01-3 Product: Prorenoate Potassium No suppilers available for the product. |
| Name | Prorenoate Potassium |
|---|---|
| Synonyms | Potassium 6,7-Dihydro-17-Hydroxy-3-Oxo-3'H-Cyclopropa(6,7)-17Alpha-Pregna-4,6-Diene-21-Carboxylate; Potassium Prorenoate; Prorenoate Potassique [Inn-French] |
| Molecular Structure | ![]() |
| Molecular Formula | C23H31KO4 |
| Molecular Weight | 410.59 |
| CAS Registry Number | 49848-01-3 |
| SMILES | [C@@H]23[C@@H]5[C@H](C1=CC(=O)CC[C@@]1([C@H]2CC[C@]4([C@H]3CC[C@]4(CCC(=O)[O-])O)C)C)C5.[K+] |
| InChI | 1S/C23H32O4.K/c1-21-7-3-13(24)11-18(21)14-12-15(14)20-16(21)4-8-22(2)17(20)5-9-23(22,27)10-6-19(25)26;/h11,14-17,20,27H,3-10,12H2,1-2H3,(H,25,26);/q;+1/p-1/t14-,15+,16+,17+,20-,21-,22+,23-;/m1./s1 |
| InChIKey | NLSAMWIBIQWHTK-CZKUEYQYSA-M |
| Boiling point | 560.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 306.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Prorenoate Potassium |