Online Database of Chemicals from Around the World
| Name | Bis(1,1-Dimethylpropyl)Naphthalene |
|---|---|
| Synonyms | 1,2-Bis(1,1-Dimethylpropyl)Naphthalene; 1,2-Ditert-Amylnaphthalene; Di(Tert-Amyl)Naphthalene |
| Molecular Structure |  |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 |
| CAS Registry Number | 50696-42-9 |
| EINECS | 256-717-6 |
| SMILES | C1=C(C(=C2C(=C1)C=CC=C2)C(CC)(C)C)C(CC)(C)C |
| InChI | 1S/C20H28/c1-7-19(3,4)17-14-13-15-11-9-10-12-16(15)18(17)20(5,6)8-2/h9-14H,7-8H2,1-6H3 |
| InChIKey | IJAPRTGBEXDTEZ-UHFFFAOYSA-N |
| Density | 0.926g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.036°C at 760 mmHg (Cal.) |
| Flash point | 187.622°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(1,1-Dimethylpropyl)Naphthalene |
