|
CAS#: 5112-65-2 Product: 4-(Trimethylsilyl)Phenylacetic Acid No suppilers available for the product. |
| Name | 4-(Trimethylsilyl)Phenylacetic Acid |
|---|---|
| Synonyms | 2-(4-Trimethylsilylphenyl)Ethanoic Acid; Nsc131588 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16O2Si |
| Molecular Weight | 208.33 |
| CAS Registry Number | 5112-65-2 |
| SMILES | C1=C(C=CC(=C1)CC(O)=O)[Si](C)(C)C |
| InChI | 1S/C11H16O2Si/c1-14(2,3)10-6-4-9(5-7-10)8-11(12)13/h4-7H,8H2,1-3H3,(H,12,13) |
| InChIKey | ICHNKKQFXDWXNO-UHFFFAOYSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.757°C at 760 mmHg (Cal.) |
| Flash point | 137.508°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(Trimethylsilyl)Phenylacetic Acid |