|
CAS#: 51123-82-1 Product: 6-[(4-Chlorophenyl)Sulfonyl]-2,4-Quinazolinediamine No suppilers available for the product. |
| Name | 6-[(4-Chlorophenyl)Sulfonyl]-2,4-Quinazolinediamine |
|---|---|
| Synonyms | [2-Amino-6-(4-Chlorophenyl)Sulfonyl-Quinazolin-4-Yl]Amine; Nsc305778; 2,4-Diamino-6-[[P-Chlorophenyl]Sulfonyl]Quinazoline |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11ClN4O2S |
| Molecular Weight | 334.78 |
| CAS Registry Number | 51123-82-1 |
| SMILES | C1=C3C(=CC=C1[S](C2=CC=C(C=C2)Cl)(=O)=O)N=C(N=C3N)N |
| InChI | 1S/C14H11ClN4O2S/c15-8-1-3-9(4-2-8)22(20,21)10-5-6-12-11(7-10)13(16)19-14(17)18-12/h1-7H,(H4,16,17,18,19) |
| InChIKey | BEOVNLZTAZDKBA-UHFFFAOYSA-N |
| Density | 1.558g/cm3 (Cal.) |
|---|---|
| Boiling point | 672.355°C at 760 mmHg (Cal.) |
| Flash point | 360.427°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-[(4-Chlorophenyl)Sulfonyl]-2,4-Quinazolinediamine |