|
CAS#: 519-56-2 Product: Phenanthro[4,5-bcd]Furan-3-Ol No suppilers available for the product. |
| Name | Phenanthro[4,5-bcd]Furan-3-Ol |
|---|---|
| Synonyms | Morphenol; Phenanthro(4,5-Bcd)Furan-3-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8O2 |
| Molecular Weight | 208.22 |
| CAS Registry Number | 519-56-2 |
| EINECS | 208-271-9 |
| SMILES | C1=CC4=C3C2=C1C(=CC=C2OC3=CC=C4)O |
| InChI | 1S/C14H8O2/c15-10-6-7-12-14-9(10)5-4-8-2-1-3-11(16-12)13(8)14/h1-7,15H |
| InChIKey | XKJNJRVYEQGWFF-UHFFFAOYSA-N |
| Density | 1.454g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.896°C at 760 mmHg (Cal.) |
| Flash point | 192.022°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenanthro[4,5-bcd]Furan-3-Ol |