|
CAS#: 52092-65-6 Product: 9beta,11beta-Epoxy-21-Hydroxy-16alpha-Methylpregna-1,4-Diene-3,20-Dione 21-Acetate No suppilers available for the product. |
| Name | 9beta,11beta-Epoxy-21-Hydroxy-16alpha-Methylpregna-1,4-Diene-3,20-Dione 21-Acetate |
|---|---|
| Synonyms | 9Beta,11Beta-Epoxy-21-Hydroxy-16Alpha-Methylpregna-1,4-Diene-3,20-Dione 21-Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 |
| CAS Registry Number | 52092-65-6 |
| EINECS | 257-657-3 |
| SMILES | [C@]123O[C@H]1C[C@]5([C@H]([C@@H]2CCC4=CC(C=C[C@]34C)=O)C[C@H]([C@@H]5C(COC(=O)C)=O)C)C |
| InChI | 1S/C24H30O5/c1-13-9-18-17-6-5-15-10-16(26)7-8-23(15,4)24(17)20(29-24)11-22(18,3)21(13)19(27)12-28-14(2)25/h7-8,10,13,17-18,20-21H,5-6,9,11-12H2,1-4H3/t13-,17+,18+,20+,21-,22+,23+,24-/m1/s1 |
| InChIKey | JKRMOSPJNPCGSZ-QNAHPZDQSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.614°C at 760 mmHg (Cal.) |
| Flash point | 234.127°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9beta,11beta-Epoxy-21-Hydroxy-16alpha-Methylpregna-1,4-Diene-3,20-Dione 21-Acetate |