|
CAS#: 52977-61-4 Product: O-(N-Nitroso-N-Methyl-beta-Alanyl)-L-Serine No suppilers available for the product. |
| Name | O-(N-Nitroso-N-Methyl-beta-Alanyl)-L-Serine |
|---|---|
| Synonyms | (2S)-2-Amino-3-[3-(Methyl-Nitroso-Amino)Propanoyloxy]Propanoic Acid; (2S)-2-Amino-3-[3-(Methyl-Nitrosoamino)-1-Oxopropoxy]Propanoic Acid; (2S)-2-Amino-3-[3-(Methyl-Nitroso-Amino)Propanoyloxy]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13N3O5 |
| Molecular Weight | 219.20 |
| CAS Registry Number | 52977-61-4 |
| SMILES | [C@H](COC(CCN(N=O)C)=O)(C(O)=O)N |
| InChI | 1S/C7H13N3O5/c1-10(9-14)3-2-6(11)15-4-5(8)7(12)13/h5H,2-4,8H2,1H3,(H,12,13)/t5-/m0/s1 |
| InChIKey | DHDBDHYZCMTTTE-YFKPBYRVSA-N |
| Density | 1.439g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.529°C at 760 mmHg (Cal.) |
| Flash point | 248.044°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-(N-Nitroso-N-Methyl-beta-Alanyl)-L-Serine |