Online Database of Chemicals from Around the World
|
CAS#: 5460-90-2 Product: 3-Amino-9-Ethyl-2,4,7,8,9-Pentazabicyclo[4.3.0]Nona-1,3,6-Triene-5-Thione No suppilers available for the product. |
| Name | 3-Amino-9-Ethyl-2,4,7,8,9-Pentazabicyclo[4.3.0]Nona-1,3,6-Triene-5-Thione |
|---|---|
| Synonyms | 5-Amino-3-Ethyl-2H-[1,2,3]Triazolo[4,5-E]Pyrimidine-7-Thione; Nsc24556 |
| Molecular Structure | ![CAS#: 5460-90-2, 3-Amino-9-Ethyl-2,4,7,8,9-Pentazabicyclo[4.3.0]Nona-1,3,6-Triene-5-Thione](/moreStructures/5460-90-2.gif) |
| Molecular Formula | C6H8N6S |
| Molecular Weight | 196.23 |
| CAS Registry Number | 5460-90-2 |
| SMILES | C(N1NN=C2C1=NC(=NC2=S)N)C |
| InChI | 1S/C6H8N6S/c1-2-12-4-3(10-11-12)5(13)9-6(7)8-4/h11H,2H2,1H3,(H2,7,9,13) |
| InChIKey | VTPUKFBAOQQSQA-UHFFFAOYSA-N |
| Density | 1.845g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.998°C at 760 mmHg (Cal.) |
| Flash point | 134.025°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-9-Ethyl-2,4,7,8,9-Pentazabicyclo[4.3.0]Nona-1,3,6-Triene-5-Thione |