|
CAS#: 54614-69-6 Product: Sodium 4-(4-Hydroxyphenyl)Phenolate No suppilers available for the product. |
| Name | Sodium 4-(4-Hydroxyphenyl)Phenolate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H9NaO2 |
| Molecular Weight | 208.19 |
| CAS Registry Number | 54614-69-6 |
| EINECS | 259-254-8 |
| SMILES | C2=C(C1=CC=C(O)C=C1)C=CC(=C2)[O-].[Na+] |
| InChI | 1S/C12H10O2.Na/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;/h1-8,13-14H;/q;+1/p-1 |
| InChIKey | XPFZNHSLPJKFAS-UHFFFAOYSA-M |
| Boiling point | 355.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 176.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 4-(4-Hydroxyphenyl)Phenolate |