|
CAS#: 54805-04-8 Product: N-(((Ethoxycarbonyl)amino)methyl)-L-isoleucine No suppilers available for the product. |
| Name | N-(((Ethoxycarbonyl)amino)methyl)-L-isoleucine |
|---|---|
| Synonyms | (2S,3S)-2-[(Ethoxycarbonylamino)Methylamino]-3-Methyl-Pentanoic Acid; (2S,3S)-2-[(Carbethoxyamino)Methylamino]-3-Methyl-Valeric Acid; A-145 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 |
| CAS Registry Number | 54805-04-8 |
| SMILES | [C@@H](NCNC(OCC)=O)(C(O)=O)[C@H](CC)C |
| InChI | 1S/C10H20N2O4/c1-4-7(3)8(9(13)14)11-6-12-10(15)16-5-2/h7-8,11H,4-6H2,1-3H3,(H,12,15)(H,13,14)/t7-,8-/m0/s1 |
| InChIKey | SCNSGPWOIGVSNJ-YUMQZZPRSA-N |
| Density | 1.106g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.57°C at 760 mmHg (Cal.) |
| Flash point | 182.148°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(((Ethoxycarbonyl)amino)methyl)-L-isoleucine |