|
CAS#: 54965-09-2 Product: 1-(2-Chloro-3-Methylphenyl)-3-(3-Chloro-2-Methylphenyl)Urea No suppilers available for the product. |
| Name | 1-(2-Chloro-3-Methylphenyl)-3-(3-Chloro-2-Methylphenyl)Urea |
|---|---|
| Synonyms | N-(2-Chloro-3-methylphenyl)-N'-(3-chloro-2-methylphenyl)urea; N-(2-Chlo |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14Cl2N2O |
| Molecular Weight | 309.19 |
| CAS Registry Number | 54965-09-2 |
| SMILES | Clc2c(cccc2NC(=O)Nc1cccc(Cl)c1C)C |
| InChI | 1S/C15H14Cl2N2O/c1-9-5-3-8-13(14(9)17)19-15(20)18-12-7-4-6-11(16)10(12)2/h3-8H,1-2H3,(H2,18,19,20) |
| InChIKey | MPKDTPRAEDBJNE-UHFFFAOYSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.696°C at 760 mmHg (Cal.) |
| Flash point | 159.243°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chloro-3-Methylphenyl)-3-(3-Chloro-2-Methylphenyl)Urea |