|
CAS#: 55339-20-3 Product: 2-(Carboxymethyl-(1,1-Diphosphonoethyl)Amino)Acetic Acid No suppilers available for the product. |
| Name | 2-(Carboxymethyl-(1,1-Diphosphonoethyl)Amino)Acetic Acid |
|---|---|
| Synonyms | 2-(Carboxymethyl-(1,1-Diphosphonoethyl)Amino)Ethanoic Acid; Glycine, N-(Carboxymethyl)-N-(1,1-Diphosphonoethyl)-; N-(Carboxymethyl)-N-(1,1-Diphosphonoethyl)Glycine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13NO10P2 |
| Molecular Weight | 321.12 |
| CAS Registry Number | 55339-20-3 |
| SMILES | C(N(C([P](=O)(O)O)([P](O)(O)=O)C)CC(=O)O)C(O)=O |
| InChI | 1S/C6H13NO10P2/c1-6(18(12,13)14,19(15,16)17)7(2-4(8)9)3-5(10)11/h2-3H2,1H3,(H,8,9)(H,10,11)(H2,12,13,14)(H2,15,16,17) |
| InChIKey | PJXKZTFOBRSZOY-UHFFFAOYSA-N |
| Density | 1.977g/cm3 (Cal.) |
|---|---|
| Boiling point | 752.178°C at 760 mmHg (Cal.) |
| Flash point | 408.702°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Carboxymethyl-(1,1-Diphosphonoethyl)Amino)Acetic Acid |