|
CAS#: 555-91-9 Product: Zinc Diphenoxide No suppilers available for the product. |
| Name | Zinc Diphenoxide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O2Zn |
| Molecular Weight | 251.59 |
| CAS Registry Number | 555-91-9 |
| EINECS | 209-110-5 |
| SMILES | C1=CC=CC=C1[O-].C2=CC=CC=C2[O-].[Zn++] |
| InChI | 1S/2C6H6O.Zn/c2*7-6-4-2-1-3-5-6;/h2*1-5,7H;/q;;+2/p-2 |
| InChIKey | YMTQMTSQMKJKPX-UHFFFAOYSA-L |
| Boiling point | 181.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 72.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Zinc Diphenoxide |