|
CAS#: 5591-49-1 Product: Anilamate No suppilers available for the product. |
| Name | Anilamate |
|---|---|
| Synonyms | N-Methylcarbamic Acid [2-[Oxo-(Phenylamino)Methyl]Phenyl] Ester; N-Methylcarbamic Acid [2-(Phenylcarbamoyl)Phenyl] Ester; Anilamate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 |
| CAS Registry Number | 5591-49-1 |
| SMILES | C1=C(C(=CC=C1)C(NC2=CC=CC=C2)=O)OC(NC)=O |
| InChI | 1S/C15H14N2O3/c1-16-15(19)20-13-10-6-5-9-12(13)14(18)17-11-7-3-2-4-8-11/h2-10H,1H3,(H,16,19)(H,17,18) |
| InChIKey | BEECRKDUIIQEBI-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.9°C at 760 mmHg (Cal.) |
| Flash point | 166.623°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Anilamate |