|
CAS#: 57308-24-4 Product: Centdarol No suppilers available for the product. |
| Name | Centdarol |
|---|---|
| Synonyms | C09632; Centarol; Centdarol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 |
| CAS Registry Number | 57308-24-4 |
| SMILES | [C@@H]12[C@@H](CC=C([C@@H]1O)C)[C@@](O)(CCCC2(C)C)C |
| InChI | 1S/C15H26O2/c1-10-6-7-11-12(13(10)16)14(2,3)8-5-9-15(11,4)17/h6,11-13,16-17H,5,7-9H2,1-4H3/t11-,12-,13+,15+/m1/s1 |
| InChIKey | NUXLUAXOQWMFEE-CXTNEJHOSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.621°C at 760 mmHg (Cal.) |
| Flash point | 155.32°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Centdarol |