|
CAS#: 58344-35-7 Product: 1-(2,3-Dihydro-1,4-Benzodioxin-6-Yl)-4,4-Dimethyl-1-Penten-3-One No suppilers available for the product. |
| Name | 1-(2,3-Dihydro-1,4-Benzodioxin-6-Yl)-4,4-Dimethyl-1-Penten-3-One |
|---|---|
| Synonyms | (E)-1-(2,3-Dihydro-1,4-Benzodioxin-7-Yl)-4,4-Dimethyl-Pent-1-En-3-One; 1-Penten-3-One, 4,4-Dimethyl-1-(3,4-Ethylenedioxyphenyl)-; 4,4-Dimethyl-1-(3,4-Ethylenedioxyphenyl)-1-Penten-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 |
| CAS Registry Number | 58344-35-7 |
| SMILES | C2=C1OCCOC1=CC=C2\C=C\C(C(C)(C)C)=O |
| InChI | 1S/C15H18O3/c1-15(2,3)14(16)7-5-11-4-6-12-13(10-11)18-9-8-17-12/h4-7,10H,8-9H2,1-3H3/b7-5+ |
| InChIKey | AXZABNFIPMYYKU-FNORWQNLSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.576°C at 760 mmHg (Cal.) |
| Flash point | 173.59°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,3-Dihydro-1,4-Benzodioxin-6-Yl)-4,4-Dimethyl-1-Penten-3-One |