|
CAS#: 6030-03-1 Product: 2-Methyl-4-Ethyl-4-Dimethylaminoazobenzene No suppilers available for the product. |
| Name | 2-Methyl-4-Ethyl-4-Dimethylaminoazobenzene |
|---|---|
| Synonyms | 4-(4-Ethylphenyl)Azo-N,N,3-Trimethyl-Aniline; 4-(4-Ethylphenyl)Azo-N,N,3-Trimethylaniline; [4-(4-Ethylphenyl)Azo-3-Methyl-Phenyl]-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.37 |
| CAS Registry Number | 6030-03-1 |
| SMILES | C1=CC(=CC(=C1N=NC2=CC=C(C=C2)CC)C)N(C)C |
| InChI | 1S/C17H21N3/c1-5-14-6-8-15(9-7-14)18-19-17-11-10-16(20(3)4)12-13(17)2/h6-12H,5H2,1-4H3 |
| InChIKey | LEEMOVONVYCRIF-UHFFFAOYSA-N |
| Density | 1.005g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.185°C at 760 mmHg (Cal.) |
| Flash point | 206.711°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-Ethyl-4-Dimethylaminoazobenzene |