Online Database of Chemicals from Around the World
|
CAS#: 6030-91-7 Product: 3-Acetoxyestra-1,3,5,7,9-Pentene-17-One No suppilers available for the product. |
| Name | 3-Acetoxyestra-1,3,5,7,9-Pentene-17-One |
|---|---|
| Synonyms | Acetic Acid (13-Methyl-17-Oxo-12,14,15,16-Tetrahydro-11H-Cyclopenta[A]Phenanthren-3-Yl) Ester; Acetic Acid (17-Keto-13-Methyl-12,14,15,16-Tetrahydro-11H-Cyclopenta[A]Phenanthren-3-Yl) Ester; (13-Methyl-17-Oxo-12,14,15,16-Tetrahydro-11H-Cyclopenta[A]Phenanthren-3-Yl) Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 |
| CAS Registry Number | 6030-91-7 |
| SMILES | C1=CC4=C(C3=C1C2C(C(=O)CC2)(C)CC3)C=CC(=C4)OC(C)=O |
| InChI | 1S/C20H20O3/c1-12(21)23-14-4-6-15-13(11-14)3-5-17-16(15)9-10-20(2)18(17)7-8-19(20)22/h3-6,11,18H,7-10H2,1-2H3 |
| InChIKey | BXYLRGRVWPHELN-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.743°C at 760 mmHg (Cal.) |
| Flash point | 213.626°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Acetoxyestra-1,3,5,7,9-Pentene-17-One |