|
CAS#: 60301-98-6 Product: 3-(2-Methylphenyl)-1,1-Diphenyl-Urea No suppilers available for the product. |
| Name | 3-(2-Methylphenyl)-1,1-Diphenyl-Urea |
|---|---|
| Synonyms | Nsc41676 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 |
| CAS Registry Number | 60301-98-6 |
| SMILES | C1=CC=CC(=C1C)NC(=O)N(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C20H18N2O/c1-16-10-8-9-15-19(16)21-20(23)22(17-11-4-2-5-12-17)18-13-6-3-7-14-18/h2-15H,1H3,(H,21,23) |
| InChIKey | JTHGOOGVRDDYSA-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.488°C at 760 mmHg (Cal.) |
| Flash point | 251.043°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Methylphenyl)-1,1-Diphenyl-Urea |